C23H22INO9 — CID 58647968
ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-10-iodo-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate (PubChem CID 58647968) has the molecular formula C23H22INO9 and a molecular weight of 583.33 g/mol. Its IUPAC name is ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-10-iodo-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-10-iodo-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 58647968 |
| Molecular Formula | C23H22INO9 |
| Molecular Weight | 583.33 g/mol |
| Exact Mass | 583.03 |
| IUPAC Name | ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-10-iodo-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
| SMILES | CCOC(=O)COC1=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(I)c4C[C@H]3C[C@H]2C1 |
| InChI | InChI=1S/C23H22INO9/c1-2-33-15(27)8-34-14-7-10-5-9-6-11-12(24)3-4-13(26)17(11)19(28)16(9)20(29)23(10,32)21(30)18(14)22(25)31/h3-4,9-10,26,28,32H,2,5-8H2,1H3,(H2,25,31)/t9-,10+,23+/m1/s1 |
| InChIKey | WLTFFQQXYNRYDN-WUGBYWSNSA-N |
| XLogP | 1.05 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|