C25H24N2O7S — CID 140505751
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505751) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505751 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1ncsc1CCc1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H24N2O7S/c1-10-17(35-9-27-10)5-3-11-2-4-15(28)19-14(11)7-12-6-13-8-16(29)20(24(26)33)23(32)25(13,34)22(31)18(12)21(19)30/h2,4,9,12-13,28,30,32,34H,3,5-8H2,1H3,(H2,26,33)/t12-,13+,25+/m1/s1 |
| InChIKey | CJEVTTTXEHBHNV-OCDDVZBJSA-N |
| XLogP | 1.97 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|