C28H25NO10 — CID 58648055
(4-methoxyphenyl) 2-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]acetate (PubChem CID 58648055) has the molecular formula C28H25NO10 and a molecular weight of 535.51 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]acetate.
| Compound Name | (4-methoxyphenyl) 2-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]acetate |
|---|---|
| PubChem CID | 58648055 |
| Molecular Formula | C28H25NO10 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | (4-methoxyphenyl) 2-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]acetate |
| SMILES | COc1ccc(OC(=O)Cc2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C28H25NO10/c1-38-15-3-5-16(6-4-15)39-20(32)10-12-2-7-18(30)22-17(12)9-13-8-14-11-19(31)23(27(29)36)26(35)28(14,37)25(34)21(13)24(22)33/h2-7,13-14,30,33,35,37H,8-11H2,1H3,(H2,29,36)/t13-,14+,28+/m1/s1 |
| InChIKey | OPOKVKOVNQWJAZ-VSGRFQRGSA-N |
| XLogP | 1.58 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|