C27H24N2O9 — CID 54723095
(4-methylphenyl) N-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)carbamate (PubChem CID 54723095) has the molecular formula C27H24N2O9 and a molecular weight of 520.49 g/mol. Its IUPAC name is (4-methylphenyl) N-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)carbamate.
| Compound Name | (4-methylphenyl) N-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)carbamate |
|---|---|
| PubChem CID | 54723095 |
| Molecular Formula | C27H24N2O9 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (4-methylphenyl) N-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)carbamate |
| SMILES | Cc1ccc(OC(=O)Nc2ccc(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C27H24N2O9/c1-11-2-4-14(5-3-11)38-26(36)29-16-6-7-17(30)20-15(16)9-12-8-13-10-18(31)21(25(28)35)24(34)27(13,37)23(33)19(12)22(20)32/h2-7,12-13,30,32,34,37H,8-10H2,1H3,(H2,28,35)(H,29,36) |
| InChIKey | NMXJOVQVTCIKPM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|