C33H28N2O10 — CID 54722412
(4-methoxyphenyl) N-[4-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)phenyl]carbamate (PubChem CID 54722412) has the molecular formula C33H28N2O10 and a molecular weight of 612.59 g/mol. Its IUPAC name is (4-methoxyphenyl) N-[4-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)phenyl]carbamate.
| Compound Name | (4-methoxyphenyl) N-[4-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 54722412 |
| Molecular Formula | C33H28N2O10 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | (4-methoxyphenyl) N-[4-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)phenyl]carbamate |
| SMILES | COc1ccc(OC(=O)Nc2ccc(-c3ccc(O)c4c3CC3CC5CC(=O)C(C(N)=O)=C(O)C5(O)C(=O)C3=C4O)cc2)cc1 |
| InChI | InChI=1S/C33H28N2O10/c1-44-19-6-8-20(9-7-19)45-32(42)35-18-4-2-15(3-5-18)21-10-11-23(36)26-22(21)13-16-12-17-14-24(37)27(31(34)41)30(40)33(17,43)29(39)25(16)28(26)38/h2-11,16-17,36,38,40,43H,12-14H2,1H3,(H2,34,41)(H,35,42) |
| InChIKey | XJIDJUOSRZIHBS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 205.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|