C26H22O9 — CID 148675461
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(4-methoxyphenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid (PubChem CID 148675461) has the molecular formula C26H22O9 and a molecular weight of 478.45 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(4-methoxyphenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(4-methoxyphenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 148675461 |
| Molecular Formula | C26H22O9 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(4-methoxyphenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(=O)O)=C(O)[C@@]4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C26H22O9/c1-35-14-4-2-11(3-5-14)15-6-7-17(27)20-16(15)9-12-8-13-10-18(28)21(25(32)33)24(31)26(13,34)23(30)19(12)22(20)29/h2-7,12-13,27,29,31,34H,8-10H2,1H3,(H,32,33)/t12-,13+,26+/m1/s1 |
| InChIKey | NWRWOQGLGFGZTM-ZCDIYMNCSA-N |
| XLogP | 2.70 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|