C27H27N3O7 — CID 159311428
(5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[4-(methyliminomethylamino)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;molecular hydrogen (PubChem CID 159311428) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is (5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[4-(methyliminomethylamino)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;molecular hydrogen.
| Compound Name | (5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[4-(methyliminomethylamino)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159311428 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[4-(methyliminomethylamino)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;molecular hydrogen |
| SMILES | C/N=C/Nc1ccc(-c2ccc(O)c3c2C[C@H]2CC4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cc1.[H][H] |
| InChI | InChI=1S/C27H25N3O7.H2/c1-29-11-30-15-4-2-12(3-5-15)16-6-7-18(31)21-17(16)9-13-8-14-10-19(32)22(26(28)36)25(35)27(14,37)24(34)20(13)23(21)33;/h2-7,11,13-14,31,33,35,37H,8-10H2,1H3,(H2,28,36)(H,29,30);1H/t13-,14?,27+;/m1./s1 |
| InChIKey | DJJGFDMGYPRKPE-IWAUOJCWSA-N |
| XLogP | 2.41 |
| TPSA | 182.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|