C22H17NO9 — CID 137143764
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(1,3-oxazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid (PubChem CID 137143764) has the molecular formula C22H17NO9 and a molecular weight of 439.38 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(1,3-oxazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(1,3-oxazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 137143764 |
| Molecular Formula | C22H17NO9 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-(1,3-oxazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ncco5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C22H17NO9/c24-12-2-1-10(20-23-3-4-32-20)11-6-8-5-9-7-13(25)16(21(29)30)19(28)22(9,31)18(27)14(8)17(26)15(11)12/h1-4,8-9,24,26,28,31H,5-7H2,(H,29,30)/t8-,9+,22+/m1/s1 |
| InChIKey | NRPAINOMERLOLB-PCVAMMEBSA-N |
| XLogP | 1.68 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|