C25H28N2O9 — CID 54723034
2-methylpropyl N-[(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)methyl]carbamate (PubChem CID 54723034) has the molecular formula C25H28N2O9 and a molecular weight of 500.50 g/mol. Its IUPAC name is 2-methylpropyl N-[(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)methyl]carbamate.
| Compound Name | 2-methylpropyl N-[(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 54723034 |
| Molecular Formula | C25H28N2O9 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-methylpropyl N-[(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)methyl]carbamate |
| SMILES | CC(C)COC(=O)NCc1ccc(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H28N2O9/c1-10(2)9-36-24(34)27-8-11-3-4-15(28)18-14(11)6-12-5-13-7-16(29)19(23(26)33)22(32)25(13,35)21(31)17(12)20(18)30/h3-4,10,12-13,28,30,32,35H,5-9H2,1-2H3,(H2,26,33)(H,27,34) |
| InChIKey | GMPISWYIKSOFGR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|