C27H31NO7 — CID 118018389
(4aR)-10-[(cyclopentylamino)methyl]-4,4a,6,7-tetrahydroxy-3-propanoyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 118018389) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (4aR)-10-[(cyclopentylamino)methyl]-4,4a,6,7-tetrahydroxy-3-propanoyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR)-10-[(cyclopentylamino)methyl]-4,4a,6,7-tetrahydroxy-3-propanoyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 118018389 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (4aR)-10-[(cyclopentylamino)methyl]-4,4a,6,7-tetrahydroxy-3-propanoyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CCC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(CNC5CCCC5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C27H31NO7/c1-2-18(29)23-20(31)11-15-9-14-10-17-13(12-28-16-5-3-4-6-16)7-8-19(30)22(17)24(32)21(14)25(33)27(15,35)26(23)34/h7-8,14-16,28,30,32,34-35H,2-6,9-12H2,1H3/t14?,15?,27-/m0/s1 |
| InChIKey | CTYCEJSPFOAIBC-GAYSSHTFSA-N |
| XLogP | 2.95 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|