C29H37NO7 — CID 148898208
(4aR,11aR,12aS)-10-[3-(dimethylamino)propyl]-3-(3,3-dimethylbutanoyl)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 148898208) has the molecular formula C29H37NO7 and a molecular weight of 511.62 g/mol. Its IUPAC name is (4aR,11aR,12aS)-10-[3-(dimethylamino)propyl]-3-(3,3-dimethylbutanoyl)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-10-[3-(dimethylamino)propyl]-3-(3,3-dimethylbutanoyl)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 148898208 |
| Molecular Formula | C29H37NO7 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | (4aR,11aR,12aS)-10-[3-(dimethylamino)propyl]-3-(3,3-dimethylbutanoyl)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CN(C)CCCc1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(=O)CC(C)(C)C)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H37NO7/c1-28(2,3)14-21(33)24-20(32)13-17-11-16-12-18-15(7-6-10-30(4)5)8-9-19(31)23(18)25(34)22(16)26(35)29(17,37)27(24)36/h8-9,16-17,31,34,36-37H,6-7,10-14H2,1-5H3/t16-,17+,29+/m1/s1 |
| InChIKey | UFBZSBDYJTZDAM-WWTSWKCXSA-N |
| XLogP | 3.44 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|