C25H25F3N2O7 — CID 121288150
(1S,4aR,11aR,12aS)-3-acetyl-1-amino-4,4a,6,7-tetrahydroxy-9-pyrrolidin-2-yl-10-(trifluoromethyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 121288150) has the molecular formula C25H25F3N2O7 and a molecular weight of 522.48 g/mol. Its IUPAC name is (1S,4aR,11aR,12aS)-3-acetyl-1-amino-4,4a,6,7-tetrahydroxy-9-pyrrolidin-2-yl-10-(trifluoromethyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11aR,12aS)-3-acetyl-1-amino-4,4a,6,7-tetrahydroxy-9-pyrrolidin-2-yl-10-(trifluoromethyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 121288150 |
| Molecular Formula | C25H25F3N2O7 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (1S,4aR,11aR,12aS)-3-acetyl-1-amino-4,4a,6,7-tetrahydroxy-9-pyrrolidin-2-yl-10-(trifluoromethyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5)c(C(F)(F)F)c4C[C@H]3C[C@H]2[C@H](N)C1=O |
| InChI | InChI=1S/C25H25F3N2O7/c1-8(31)15-21(34)19(29)12-6-9-5-11-17(20(33)16(9)23(36)24(12,37)22(15)35)14(32)7-10(13-3-2-4-30-13)18(11)25(26,27)28/h7,9,12-13,19,30,32-33,35,37H,2-6,29H2,1H3/t9-,12-,13?,19-,24+/m0/s1 |
| InChIKey | VLYXIEUKDXPIJW-LDJFQXNPSA-N |
| XLogP | 1.91 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|