C27H29F3N4O6 — CID 162572727
(3R,6S,10R)-5-ethyl-7,10,13,15-tetrahydroxy-9-imino-11-oxo-17-pyrrolidin-2-yl-18-(trifluoromethyl)-5-azapentacyclo[10.8.0.03,6.03,10.014,19]icosa-7,12,14,16,18-pentaene-8-carboxamide (PubChem CID 162572727) has the molecular formula C27H29F3N4O6 and a molecular weight of 562.55 g/mol. Its IUPAC name is (3R,6S,10R)-5-ethyl-7,10,13,15-tetrahydroxy-9-imino-11-oxo-17-pyrrolidin-2-yl-18-(trifluoromethyl)-5-azapentacyclo[10.8.0.03,6.03,10.014,19]icosa-7,12,14,16,18-pentaene-8-carboxamide.
| Compound Name | (3R,6S,10R)-5-ethyl-7,10,13,15-tetrahydroxy-9-imino-11-oxo-17-pyrrolidin-2-yl-18-(trifluoromethyl)-5-azapentacyclo[10.8.0.03,6.03,10.014,19]icosa-7,12,14,16,18-pentaene-8-carboxamide |
|---|---|
| PubChem CID | 162572727 |
| Molecular Formula | C27H29F3N4O6 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (3R,6S,10R)-5-ethyl-7,10,13,15-tetrahydroxy-9-imino-11-oxo-17-pyrrolidin-2-yl-18-(trifluoromethyl)-5-azapentacyclo[10.8.0.03,6.03,10.014,19]icosa-7,12,14,16,18-pentaene-8-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)[C@H]2N(CC)C[C@]23CC2Cc4c(c(O)cc(C5CCCN5)c4C(F)(F)F)C(O)=C2C(=O)[C@]13O |
| InChI | InChI=1S/C27H29F3N4O6/c1-2-34-9-25-8-10-6-12-16(14(35)7-11(13-4-3-5-33-13)18(12)27(28,29)30)19(36)15(10)23(38)26(25,40)21(31)17(24(32)39)20(37)22(25)34/h7,10,13,22,31,33,35-37,40H,2-6,8-9H2,1H3,(H2,32,39)/b31-21+/t10?,13?,22-,25-,26-/m1/s1 |
| InChIKey | GQRYQAMNOOAHRU-VWRUTOBFSA-N |
| XLogP | 2.00 |
| TPSA | 180.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|