C27H30F3N3O8 — CID 73388190
(4S,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(3-hydroxypropylamino)-3,12-dioxo-8-pyrrolidin-2-yl-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 73388190) has the molecular formula C27H30F3N3O8 and a molecular weight of 581.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(3-hydroxypropylamino)-3,12-dioxo-8-pyrrolidin-2-yl-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(3-hydroxypropylamino)-3,12-dioxo-8-pyrrolidin-2-yl-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 73388190 |
| Molecular Formula | C27H30F3N3O8 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(3-hydroxypropylamino)-3,12-dioxo-8-pyrrolidin-2-yl-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5)c(C(F)(F)F)c4C[C@H]3C[C@H]2[C@H](NCCCO)C1=O |
| InChI | InChI=1S/C27H30F3N3O8/c28-27(29,30)19-11(14-3-1-4-32-14)9-15(35)17-12(19)7-10-8-13-20(33-5-2-6-34)22(37)18(25(31)40)24(39)26(13,41)23(38)16(10)21(17)36/h9-10,13-14,20,32-36,39,41H,1-8H2,(H2,31,40)/t10-,13-,14?,20-,26-/m0/s1 |
| InChIKey | XGALLVBKWFGFPV-STKXQDIKSA-N |
| XLogP | 0.82 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|