C28H35F3N4O5 — CID 138509381
(5aR)-8-(1-aminobutyl)-4-(diethylamino)-3,10,11-trihydroxy-1-imino-12-oxo-7-(trifluoromethyl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 138509381) has the molecular formula C28H35F3N4O5 and a molecular weight of 564.61 g/mol. Its IUPAC name is (5aR)-8-(1-aminobutyl)-4-(diethylamino)-3,10,11-trihydroxy-1-imino-12-oxo-7-(trifluoromethyl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (5aR)-8-(1-aminobutyl)-4-(diethylamino)-3,10,11-trihydroxy-1-imino-12-oxo-7-(trifluoromethyl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 138509381 |
| Molecular Formula | C28H35F3N4O5 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (5aR)-8-(1-aminobutyl)-4-(diethylamino)-3,10,11-trihydroxy-1-imino-12-oxo-7-(trifluoromethyl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)C(N(CC)CC)C2C[C@@H]3Cc4c(c(O)cc(C(N)CCC)c4C(F)(F)F)C(O)=C3C(=O)C12 |
| InChI | InChI=1S/C28H35F3N4O5/c1-4-7-15(32)12-10-16(36)18-13(21(12)28(29,30)31)8-11-9-14-19(25(38)17(11)24(18)37)22(33)20(27(34)40)26(39)23(14)35(5-2)6-3/h10-11,14-15,19,23,33,36-37,39H,4-9,32H2,1-3H3,(H2,34,40)/b33-22-/t11-,14?,15?,19?,23?/m0/s1 |
| InChIKey | FUUQNOSWJBJFEF-TYGIGERYSA-N |
| XLogP | 3.90 |
| TPSA | 173.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|