C32H43N3O5 — CID 173475486
(1E,4S)-4-(dimethylamino)-1-hexan-2-ylidene-3,10,11-trihydroxy-12-oxo-7-piperidin-4-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 173475486) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is (1E,4S)-4-(dimethylamino)-1-hexan-2-ylidene-3,10,11-trihydroxy-12-oxo-7-piperidin-4-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (1E,4S)-4-(dimethylamino)-1-hexan-2-ylidene-3,10,11-trihydroxy-12-oxo-7-piperidin-4-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 173475486 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | (1E,4S)-4-(dimethylamino)-1-hexan-2-ylidene-3,10,11-trihydroxy-12-oxo-7-piperidin-4-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCC/C(C)=C1/C(C(N)=O)=C(O)[C@@H](N(C)C)C2CC3Cc4c(C5CCNCC5)ccc(O)c4C(O)=C3C(=O)C12 |
| InChI | InChI=1S/C32H43N3O5/c1-5-6-7-16(2)23-26-21(28(35(3)4)31(39)27(23)32(33)40)15-18-14-20-19(17-10-12-34-13-11-17)8-9-22(36)25(20)29(37)24(18)30(26)38/h8-9,17-18,21,26,28,34,36-37,39H,5-7,10-15H2,1-4H3,(H2,33,40)/b23-16+/t18?,21?,26?,28-/m0/s1 |
| InChIKey | GUMMRSIYVIDLOW-GNXWZNROSA-N |
| XLogP | 4.25 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |