C31H30N4O8 — CID 89278684
N-[4-[(10S)-8-carbamoyl-10-(dimethylamino)-4,5,9-trihydroxy-6,7-dioxo-6a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 89278684) has the molecular formula C31H30N4O8 and a molecular weight of 586.60 g/mol. Its IUPAC name is N-[4-[(10S)-8-carbamoyl-10-(dimethylamino)-4,5,9-trihydroxy-6,7-dioxo-6a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-[(10S)-8-carbamoyl-10-(dimethylamino)-4,5,9-trihydroxy-6,7-dioxo-6a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 89278684 |
| Molecular Formula | C31H30N4O8 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | N-[4-[(10S)-8-carbamoyl-10-(dimethylamino)-4,5,9-trihydroxy-6,7-dioxo-6a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)C6CC=NO6)cc5)c4CC3CC21 |
| InChI | InChI=1S/C31H30N4O8/c1-35(2)25-18-12-14-11-17-16(13-3-5-15(6-4-13)34-31(42)20-9-10-33-43-20)7-8-19(36)22(17)26(37)21(14)27(38)23(18)28(39)24(29(25)40)30(32)41/h3-8,10,14,18,20,23,25,36-37,40H,9,11-12H2,1-2H3,(H2,32,41)(H,34,42)/t14?,18?,20?,23?,25-/m0/s1 |
| InChIKey | YVCWFRSFEKHXIR-DTADDYPISA-N |
| XLogP | 2.23 |
| TPSA | 191.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|