C32H39N3O6 — CID 70790686
(4S)-7-(1-cyclohexyl-3,6-dihydro-2H-pyridin-4-yl)-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70790686) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is (4S)-7-(1-cyclohexyl-3,6-dihydro-2H-pyridin-4-yl)-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-7-(1-cyclohexyl-3,6-dihydro-2H-pyridin-4-yl)-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70790686 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | (4S)-7-(1-cyclohexyl-3,6-dihydro-2H-pyridin-4-yl)-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(O)ccc(C5=CCN(C6CCCCC6)CC5)c4CC3CC21 |
| InChI | InChI=1S/C32H39N3O6/c1-34(2)27-21-15-17-14-20-19(16-10-12-35(13-11-16)18-6-4-3-5-7-18)8-9-22(36)24(20)28(37)23(17)29(38)25(21)30(39)26(31(27)40)32(33)41/h8-10,17-18,21,25,27,36-37,40H,3-7,11-15H2,1-2H3,(H2,33,41)/t17?,21?,25?,27-/m0/s1 |
| InChIKey | VYFQEZVUGRXOHY-NJDVJRLUSA-N |
| XLogP | 3.27 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|