C28H32F3N3O7 — CID 138509365
(4S,5aR)-4-[ethyl(methyl)amino]-3,10,11-trihydroxy-1,12-dioxo-8-(pyrrolidin-1-ylmethyl)-7-(trifluoromethoxy)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 138509365) has the molecular formula C28H32F3N3O7 and a molecular weight of 579.57 g/mol. Its IUPAC name is (4S,5aR)-4-[ethyl(methyl)amino]-3,10,11-trihydroxy-1,12-dioxo-8-(pyrrolidin-1-ylmethyl)-7-(trifluoromethoxy)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,5aR)-4-[ethyl(methyl)amino]-3,10,11-trihydroxy-1,12-dioxo-8-(pyrrolidin-1-ylmethyl)-7-(trifluoromethoxy)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 138509365 |
| Molecular Formula | C28H32F3N3O7 |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (4S,5aR)-4-[ethyl(methyl)amino]-3,10,11-trihydroxy-1,12-dioxo-8-(pyrrolidin-1-ylmethyl)-7-(trifluoromethoxy)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CCN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(O)cc(CN5CCCC5)c(OC(F)(F)F)c4C[C@H]3CC21 |
| InChI | InChI=1S/C28H32F3N3O7/c1-3-33(2)21-14-8-12-9-15-18(22(36)17(12)23(37)19(14)24(38)20(25(21)39)27(32)40)16(35)10-13(11-34-6-4-5-7-34)26(15)41-28(29,30)31/h10,12,14,19,21,35-36,39H,3-9,11H2,1-2H3,(H2,32,40)/t12-,14?,19?,21+/m1/s1 |
| InChIKey | XETWMESWTPDGAX-LCLOJRGNSA-N |
| XLogP | 2.73 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|