C33H40N4O6 — CID 71104245
9-(2-amino-2-methyl-3-phenylpropyl)-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 71104245) has the molecular formula C33H40N4O6 and a molecular weight of 588.71 g/mol. Its IUPAC name is 9-(2-amino-2-methyl-3-phenylpropyl)-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-(2-amino-2-methyl-3-phenylpropyl)-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 71104245 |
| Molecular Formula | C33H40N4O6 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 9-(2-amino-2-methyl-3-phenylpropyl)-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CC(C)(N)Cc2ccccc2)c(O)c2c1CC1CC3C(C(=O)C(C(N)=O)=C(O)C3N(C)C)C(=O)C1=C2O |
| InChI | InChI=1S/C33H40N4O6/c1-33(35,14-16-9-7-6-8-10-16)15-18-13-21(36(2)3)19-11-17-12-20-24(29(40)22(17)28(39)23(19)27(18)38)30(41)25(32(34)43)31(42)26(20)37(4)5/h6-10,13,17,20,24,26,38-39,42H,11-12,14-15,35H2,1-5H3,(H2,34,43) |
| InChIKey | SJAFOPWIQXXHIX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|