C33H41FN4O5 — CID 71104309
(4S)-9-[2-amino-3-(2-fluorophenyl)-2-methylpropyl]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydro-1H-tetracene-2-carboxamide (PubChem CID 71104309) has the molecular formula C33H41FN4O5 and a molecular weight of 592.71 g/mol. Its IUPAC name is (4S)-9-[2-amino-3-(2-fluorophenyl)-2-methylpropyl]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydro-1H-tetracene-2-carboxamide.
| Compound Name | (4S)-9-[2-amino-3-(2-fluorophenyl)-2-methylpropyl]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 71104309 |
| Molecular Formula | C33H41FN4O5 |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | (4S)-9-[2-amino-3-(2-fluorophenyl)-2-methylpropyl]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydro-1H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CC(C)(N)Cc2ccccc2F)c(O)c2c1CC1CC3C(CC(C(N)=O)=C(O)[C@H]3N(C)C)C(=O)C1=C2O |
| InChI | InChI=1S/C33H41FN4O5/c1-33(36,14-16-8-6-7-9-23(16)34)15-18-12-24(37(2)3)21-11-17-10-19-20(29(40)25(17)31(42)26(21)28(18)39)13-22(32(35)43)30(41)27(19)38(4)5/h6-9,12,17,19-20,27,39,41-42H,10-11,13-15,36H2,1-5H3,(H2,35,43)/t17?,19?,20?,27-,33?/m0/s1 |
| InChIKey | VJMULXNISMEOGN-PIFRNSFESA-N |
| XLogP | 3.38 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |