C31H43N3O6 — CID 89278681
(4S)-9-(2-amino-2-methylpent-4-enyl)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-propan-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 89278681) has the molecular formula C31H43N3O6 and a molecular weight of 553.70 g/mol. Its IUPAC name is (4S)-9-(2-amino-2-methylpent-4-enyl)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-propan-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-9-(2-amino-2-methylpent-4-enyl)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-propan-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 89278681 |
| Molecular Formula | C31H43N3O6 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | (4S)-9-(2-amino-2-methylpent-4-enyl)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-propan-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | C=CCC(C)(N)Cc1cc(C(C)C)c2c(c1O)C(O)=C1C(=O)C3C(CC1C2)[C@H](N(C)C)C(O)=C(C(N)=O)C3(C)O |
| InChI | InChI=1S/C31H43N3O6/c1-8-9-30(4,33)13-16-12-17(14(2)3)18-10-15-11-19-22(27(37)20(15)26(36)21(18)25(16)35)31(5,40)23(29(32)39)28(38)24(19)34(6)7/h8,12,14-15,19,22,24,35-36,38,40H,1,9-11,13,33H2,2-7H3,(H2,32,39)/t15?,19?,22?,24-,30?,31?/m0/s1 |
| InChIKey | NTHOPMYFIPZUAO-IHVNGQBVSA-N |
| XLogP | 2.99 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|