C32H39N3O8 — CID 70796955
4-(dimethylamino)-1,1,3,10,11-pentahydroxy-7-[3-[(4-methylpiperidin-1-yl)methyl]furan-2-yl]-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70796955) has the molecular formula C32H39N3O8 and a molecular weight of 593.68 g/mol. Its IUPAC name is 4-(dimethylamino)-1,1,3,10,11-pentahydroxy-7-[3-[(4-methylpiperidin-1-yl)methyl]furan-2-yl]-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,1,3,10,11-pentahydroxy-7-[3-[(4-methylpiperidin-1-yl)methyl]furan-2-yl]-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70796955 |
| Molecular Formula | C32H39N3O8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 4-(dimethylamino)-1,1,3,10,11-pentahydroxy-7-[3-[(4-methylpiperidin-1-yl)methyl]furan-2-yl]-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1CCN(Cc2ccoc2-c2ccc(O)c3c2CC2CC4C(N(C)C)C(O)=C(C(N)=O)C(O)(O)C4C(=O)C2=C3O)CC1 |
| InChI | InChI=1S/C32H39N3O8/c1-15-6-9-35(10-7-15)14-16-8-11-43-30(16)18-4-5-21(36)23-19(18)12-17-13-20-24(28(38)22(17)27(23)37)32(41,42)25(31(33)40)29(39)26(20)34(2)3/h4-5,8,11,15,17,20,24,26,36-37,39,41-42H,6-7,9-10,12-14H2,1-3H3,(H2,33,40) |
| InChIKey | OPCMYILJIZEUKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|