C31H34FN3O8 — CID 54677677
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[(4-fluoropiperidin-1-yl)methyl]furan-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54677677) has the molecular formula C31H34FN3O8 and a molecular weight of 595.62 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[(4-fluoropiperidin-1-yl)methyl]furan-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[(4-fluoropiperidin-1-yl)methyl]furan-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54677677 |
| Molecular Formula | C31H34FN3O8 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[(4-fluoropiperidin-1-yl)methyl]furan-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5occc5CN5CCC(F)CC5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H34FN3O8/c1-34(2)24-19-12-15-11-18-17(27-14(7-10-43-27)13-35-8-5-16(32)6-9-35)3-4-20(36)22(18)25(37)21(15)28(39)31(19,42)29(40)23(26(24)38)30(33)41/h3-4,7,10,15-16,19,24,36-37,40,42H,5-6,8-9,11-13H2,1-2H3,(H2,33,41)/t15-,19-,24-,31-/m0/s1 |
| InChIKey | OGEHLELOZCQHJX-FRCVOEKVSA-N |
| XLogP | 2.16 |
| TPSA | 177.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|