C33H41N3O8 — CID 70893287
7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-1,1,3,10,11-pentahydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70893287) has the molecular formula C33H41N3O8 and a molecular weight of 607.70 g/mol. Its IUPAC name is 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-1,1,3,10,11-pentahydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-1,1,3,10,11-pentahydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70893287 |
| Molecular Formula | C33H41N3O8 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-1,1,3,10,11-pentahydroxy-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(OC)c(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(O)=C(C(N)=O)C(O)(O)C4C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H41N3O8/c1-6-36(7-2)15-16-8-11-23(44-5)19(12-16)18-9-10-22(37)25-20(18)13-17-14-21-26(30(39)24(17)29(25)38)33(42,43)27(32(34)41)31(40)28(21)35(3)4/h8-12,17,21,26,28,37-38,40,42-43H,6-7,13-15H2,1-5H3,(H2,34,41) |
| InChIKey | QYJHPNUEQVSGBM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|