C31H36N2O8 — CID 134184282
(4aS,5aR,12aR)-7-[5-(diethylaminomethyl)-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184282) has the molecular formula C31H36N2O8 and a molecular weight of 564.64 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[5-(diethylaminomethyl)-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[5-(diethylaminomethyl)-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184282 |
| Molecular Formula | C31H36N2O8 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (4aS,5aR,12aR)-7-[5-(diethylaminomethyl)-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(OC)c(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C31H36N2O8/c1-4-33(5-2)14-15-6-9-23(41-3)19(10-15)18-7-8-21(34)25-20(18)12-16-11-17-13-22(35)26(30(32)39)29(38)31(17,40)28(37)24(16)27(25)36/h6-10,16-17,22,26,34-36,40H,4-5,11-14H2,1-3H3,(H2,32,39)/t16-,17+,22?,26?,31+/m1/s1 |
| InChIKey | HTFNSLAGXHMRFS-BFROAILJSA-N |
| XLogP | 2.11 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|