C27H23NO8 — CID 134183641
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134183641) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134183641 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C#Cc5cccc(O)c5)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C27H23NO8/c28-26(35)22-19(31)11-15-9-14-10-17-13(5-4-12-2-1-3-16(29)8-12)6-7-18(30)21(17)23(32)20(14)24(33)27(15,36)25(22)34/h1-3,6-8,14-15,19,22,29-32,36H,9-11H2,(H2,28,35)/t14-,15+,19?,22?,27+/m1/s1 |
| InChIKey | FUJKOKMLOLLLFM-YLSBJDLOSA-N |
| XLogP | 0.69 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|