C27H20F5NO7 — CID 134184543
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184543) has the molecular formula C27H20F5NO7 and a molecular weight of 565.45 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184543 |
| Molecular Formula | C27H20F5NO7 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(/C=C/c5c(F)c(F)c(F)c(F)c5F)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C27H20F5NO7/c28-18-11(19(29)21(31)22(32)20(18)30)3-1-8-2-4-13(34)16-12(8)6-9-5-10-7-14(35)17(26(33)39)25(38)27(10,40)24(37)15(9)23(16)36/h1-4,9-10,14,17,34-36,40H,5-7H2,(H2,33,39)/b3-1+/t9-,10+,14?,17?,27+/m1/s1 |
| InChIKey | AOUGXZYNDPMHBL-AZHPAVRESA-N |
| XLogP | 2.45 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|