C27H22ClNO7 — CID 140505455
(4aS,5aR,12aR)-7-[(E)-2-(4-chlorophenyl)ethenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505455) has the molecular formula C27H22ClNO7 and a molecular weight of 507.93 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[(E)-2-(4-chlorophenyl)ethenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[(E)-2-(4-chlorophenyl)ethenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505455 |
| Molecular Formula | C27H22ClNO7 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (4aS,5aR,12aR)-7-[(E)-2-(4-chlorophenyl)ethenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(/C=C/c5ccc(Cl)cc5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C27H22ClNO7/c28-16-6-2-12(3-7-16)1-4-13-5-8-18(30)21-17(13)10-14-9-15-11-19(31)22(26(29)35)25(34)27(15,36)24(33)20(14)23(21)32/h1-8,14-15,30,32,34,36H,9-11H2,(H2,29,35)/b4-1+/t14-,15+,27+/m1/s1 |
| InChIKey | PDEQCQQKSCODSY-IFYUWLEZSA-N |
| XLogP | 3.25 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|