C24H20ClNO7 — CID 58647458
(4aS,5aR,12aR)-7-(4-chlorocyclopenta-1,3-dien-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647458) has the molecular formula C24H20ClNO7 and a molecular weight of 469.88 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(4-chlorocyclopenta-1,3-dien-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(4-chlorocyclopenta-1,3-dien-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647458 |
| Molecular Formula | C24H20ClNO7 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (4aS,5aR,12aR)-7-(4-chlorocyclopenta-1,3-dien-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C5=CC=C(Cl)C5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C24H20ClNO7/c25-12-2-1-9(6-12)13-3-4-15(27)18-14(13)7-10-5-11-8-16(28)19(23(26)32)22(31)24(11,33)21(30)17(10)20(18)29/h1-4,10-11,27,29,31,33H,5-8H2,(H2,26,32)/t10-,11+,24+/m1/s1 |
| InChIKey | LQAOKLWVJRLJOP-VLBDKCSNSA-N |
| XLogP | 2.33 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|