C25H23NO7 — CID 134184869
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7,9-bis(prop-1-ynyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184869) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7,9-bis(prop-1-ynyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7,9-bis(prop-1-ynyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184869 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7,9-bis(prop-1-ynyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC#Cc1cc(C#CC)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H23NO7/c1-3-5-11-7-12(6-4-2)20(28)18-15(11)9-13-8-14-10-16(27)19(24(26)32)23(31)25(14,33)22(30)17(13)21(18)29/h7,13-14,16,19,27-29,33H,8-10H2,1-2H3,(H2,26,32)/t13-,14+,16?,19?,25+/m1/s1 |
| InChIKey | IRNYFVOAQQZOPD-YSUCWVEPSA-N |
| XLogP | 0.33 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|