C26H30INO7S — CID 134184949
9-(cyclohexylsulfanylmethyl)-3,10,11,12a-tetrahydroxy-7-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184949) has the molecular formula C26H30INO7S and a molecular weight of 627.50 g/mol. Its IUPAC name is 9-(cyclohexylsulfanylmethyl)-3,10,11,12a-tetrahydroxy-7-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | 9-(cyclohexylsulfanylmethyl)-3,10,11,12a-tetrahydroxy-7-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184949 |
| Molecular Formula | C26H30INO7S |
| Molecular Weight | 627.50 g/mol |
| Exact Mass | 627.08 |
| IUPAC Name | 9-(cyclohexylsulfanylmethyl)-3,10,11,12a-tetrahydroxy-7-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C2(O)C(=O)C3=C(O)c4c(O)c(CSC5CCCCC5)cc(I)c4CC3CC2CC1O |
| InChI | InChI=1S/C26H30INO7S/c27-16-8-12(10-36-14-4-2-1-3-5-14)21(30)19-15(16)7-11-6-13-9-17(29)20(25(28)34)24(33)26(13,35)23(32)18(11)22(19)31/h8,11,13-14,17,20,29-31,35H,1-7,9-10H2,(H2,28,34) |
| InChIKey | SSDGBAZMLODFKK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|