C23H21F4NO8S — CID 90965139
(4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,1,2-tetrafluoropropan-2-ylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90965139) has the molecular formula C23H21F4NO8S and a molecular weight of 547.48 g/mol. Its IUPAC name is (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,1,2-tetrafluoropropan-2-ylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,1,2-tetrafluoropropan-2-ylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90965139 |
| Molecular Formula | C23H21F4NO8S |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,1,2-tetrafluoropropan-2-ylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(F)(SC[C@H]1c2cccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C23H21F4NO8S/c1-21(24,23(25,26)27)37-6-8-7-3-2-4-10(29)12(7)17(32)15-13(8)16(31)9-5-11(30)14(20(28)35)18(33)22(9,36)19(15)34/h2-4,8-9,13-16,29,31,36H,5-6H2,1H3,(H2,28,35)/t8-,9+,13+,14?,15?,16+,21?,22+/m0/s1 |
| InChIKey | PMTZUVNYDUFNQW-ZWVHCBOKSA-N |
| XLogP | 0.82 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|