C26H16F5NO8 — CID 90854251
(4aR,5S,5aS,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 90854251) has the molecular formula C26H16F5NO8 and a molecular weight of 565.40 g/mol. Its IUPAC name is (4aR,5S,5aS,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90854251 |
| Molecular Formula | C26H16F5NO8 |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | (4aR,5S,5aS,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@@H]3C(=Cc4c(F)c(F)c(F)c(F)c4F)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C26H16F5NO8/c27-16-8(17(28)19(30)20(31)18(16)29)4-7-6-2-1-3-10(33)12(6)22(36)15-13(7)21(35)9-5-11(34)14(25(32)39)23(37)26(9,40)24(15)38/h1-4,9,13-15,21,33,35,40H,5H2,(H2,32,39)/t9-,13-,14?,15?,21-,26-/m1/s1 |
| InChIKey | ZIPANYWZHSYCBZ-RTHMEIMASA-N |
| XLogP | 0.99 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|