C22H18F5NO9 — CID 58627518
(4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-(1,1,2,2,2-pentafluoroethoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627518) has the molecular formula C22H18F5NO9 and a molecular weight of 535.37 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-(1,1,2,2,2-pentafluoroethoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-(1,1,2,2,2-pentafluoroethoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627518 |
| Molecular Formula | C22H18F5NO9 |
| Molecular Weight | 535.37 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-(1,1,2,2,2-pentafluoroethoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](COC(F)(F)C(F)(F)F)[C@H]3[C@H](O)[C@H]2CC1=O |
| InChI | InChI=1S/C22H18F5NO9/c23-21(24,25)22(26,27)37-5-7-6-2-1-3-9(29)11(6)16(32)14-12(7)15(31)8-4-10(30)13(19(28)35)17(33)20(8,36)18(14)34/h1-3,7-8,12,15,29,31-33,36H,4-5H2,(H2,28,35)/t7-,8+,12+,15+,20+/m0/s1 |
| InChIKey | QEJYKCGFAOLLRE-QDJADMBNSA-N |
| XLogP | 1.11 |
| TPSA | 187.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|