C29H28FNO8 — CID 90744964
(4R,4aS,5R,5aS,6S,12aR)-7-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90744964) has the molecular formula C29H28FNO8 and a molecular weight of 537.54 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-7-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-7-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90744964 |
| Molecular Formula | C29H28FNO8 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-7-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(F)cc5)c4[C@@H](C)[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C29H28FNO8/c1-10(2)16-22-25(35)18-11(3)17-14(12-4-6-13(30)7-5-12)8-9-15(32)19(17)24(34)20(18)26(36)29(22,39)27(37)21(23(16)33)28(31)38/h4-11,16,18,20-22,25,32,35,39H,1-3H3,(H2,31,38)/t11-,16-,18+,20?,21?,22+,25-,29-/m1/s1 |
| InChIKey | KCWQPMPLYIFHIZ-ASOUXUODSA-N |
| XLogP | 1.55 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|