C28H24FNO8 — CID 90776614
(4aR,5S,5aR,6R,12aS)-9-[2-(4-fluorophenyl)ethenyl]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90776614) has the molecular formula C28H24FNO8 and a molecular weight of 521.50 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-[2-(4-fluorophenyl)ethenyl]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-[2-(4-fluorophenyl)ethenyl]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90776614 |
| Molecular Formula | C28H24FNO8 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-[2-(4-fluorophenyl)ethenyl]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(C=Cc3ccc(F)cc3)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C28H24FNO8/c1-11-15-9-6-13(5-2-12-3-7-14(29)8-4-12)22(32)19(15)24(34)21-18(11)23(33)16-10-17(31)20(27(30)37)25(35)28(16,38)26(21)36/h2-9,11,16,18,20-21,23,32-33,38H,10H2,1H3,(H2,30,37)/t11-,16+,18+,20?,21?,23+,28+/m0/s1 |
| InChIKey | KKVXXNCCWUBGLX-DGSAOJQMSA-N |
| XLogP | 1.17 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|