C27H24FNO7 — CID 58627566
(4aS,5aR,12aR)-9-[2-(4-fluorophenyl)ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627566) has the molecular formula C27H24FNO7 and a molecular weight of 493.49 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-[2-(4-fluorophenyl)ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-[2-(4-fluorophenyl)ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627566 |
| Molecular Formula | C27H24FNO7 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | (4aS,5aR,12aR)-9-[2-(4-fluorophenyl)ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(CCc5ccc(F)cc5)c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C27H24FNO7/c28-17-7-2-12(3-8-17)1-4-13-5-6-14-9-15-10-16-11-18(30)21(26(29)35)25(34)27(16,36)24(33)20(15)23(32)19(14)22(13)31/h2-3,5-8,15-16,31-32,34,36H,1,4,9-11H2,(H2,29,35)/t15-,16-,27-/m0/s1 |
| InChIKey | PFAKBUDBZXIVKP-MPEQGZPJSA-N |
| XLogP | 2.35 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|