C28H30N2O7 — CID 134184663
(4aS,5aR,12aR)-9-[2-(cyclopenten-1-yl)ethynyl]-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184663) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-[2-(cyclopenten-1-yl)ethynyl]-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-[2-(cyclopenten-1-yl)ethynyl]-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184663 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (4aS,5aR,12aR)-9-[2-(cyclopenten-1-yl)ethynyl]-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#CC2=CCCC2)c(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H30N2O7/c1-30(2)18-11-14(8-7-13-5-3-4-6-13)23(32)21-17(18)10-15-9-16-12-19(31)22(27(29)36)26(35)28(16,37)25(34)20(15)24(21)33/h5,11,15-16,19,22,31-33,37H,3-4,6,9-10,12H2,1-2H3,(H2,29,36)/t15-,16+,19?,22?,28+/m1/s1 |
| InChIKey | UBQCHFYLOOOOGK-SAZXSYQTSA-N |
| XLogP | 1.12 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|