C25H28N4O8 — CID 134184596
(4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(1,2-oxazol-3-ylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184596) has the molecular formula C25H28N4O8 and a molecular weight of 512.52 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(1,2-oxazol-3-ylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(1,2-oxazol-3-ylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184596 |
| Molecular Formula | C25H28N4O8 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(1,2-oxazol-3-ylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNc2ccon2)c(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H28N4O8/c1-29(2)14-7-11(9-27-16-3-4-37-28-16)20(31)18-13(14)6-10-5-12-8-15(30)19(24(26)35)23(34)25(12,36)22(33)17(10)21(18)32/h3-4,7,10,12,15,19,30-32,36H,5-6,8-9H2,1-2H3,(H2,26,35)(H,27,28)/t10-,12+,15?,19?,25+/m1/s1 |
| InChIKey | SYDHCDPMXTYJNQ-ZUWWENDDSA-N |
| XLogP | 0.25 |
| TPSA | 199.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|