C24H28N2O9 — CID 166899155
ethyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracene-2-carboxylate (PubChem CID 166899155) has the molecular formula C24H28N2O9 and a molecular weight of 488.49 g/mol. Its IUPAC name is ethyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracene-2-carboxylate.
| Compound Name | ethyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracene-2-carboxylate |
|---|---|
| PubChem CID | 166899155 |
| Molecular Formula | C24H28N2O9 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | ethyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H28N2O9/c1-4-35-23(33)12-8-13(26(2)3)11-6-9-5-10-7-14(27)17(22(25)32)21(31)24(10,34)20(30)15(9)19(29)16(11)18(12)28/h8-10,14,17,27-29,34H,4-7H2,1-3H3,(H2,25,32)/t9-,10+,14?,17?,24+/m1/s1 |
| InChIKey | VAIJRCVWHRQLJO-HHYFIXPISA-N |
| XLogP | -0.17 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|