C28H28ClN3O9 — CID 134184686
(4-chlorophenyl) N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]carbamate (PubChem CID 134184686) has the molecular formula C28H28ClN3O9 and a molecular weight of 586.00 g/mol. Its IUPAC name is (4-chlorophenyl) N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]carbamate.
| Compound Name | (4-chlorophenyl) N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 134184686 |
| Molecular Formula | C28H28ClN3O9 |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | (4-chlorophenyl) N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]carbamate |
| SMILES | CN(C)c1cc(NC(=O)Oc2ccc(Cl)cc2)c(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H28ClN3O9/c1-32(2)17-10-16(31-27(39)41-14-5-3-13(29)4-6-14)22(34)20-15(17)8-11-7-12-9-18(33)21(26(30)38)25(37)28(12,40)24(36)19(11)23(20)35/h3-6,10-12,18,21,33-35,40H,7-9H2,1-2H3,(H2,30,38)(H,31,39)/t11-,12+,18?,21?,28+/m1/s1 |
| InChIKey | ZYVPPQHBQWAJJL-AQMGHVMISA-N |
| XLogP | 1.92 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|