C27H34N4O8 — CID 134185033
N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 134185033) has the molecular formula C27H34N4O8 and a molecular weight of 542.59 g/mol. Its IUPAC name is N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134185033 |
| Molecular Formula | C27H34N4O8 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,8,10a,12-tetrahydroxy-10,11-dioxo-5a,6,6a,7,8,9-hexahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)C2CCCN2)c(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H34N4O8/c1-31(2)16-8-12(10-30-26(38)15-4-3-5-29-15)21(33)19-14(16)7-11-6-13-9-17(32)20(25(28)37)24(36)27(13,39)23(35)18(11)22(19)34/h8,11,13,15,17,20,29,32-34,39H,3-7,9-10H2,1-2H3,(H2,28,37)(H,30,38)/t11-,13+,15?,17?,20?,27+/m1/s1 |
| InChIKey | ONUTTYPEPCOIKR-BCYCVGALSA-N |
| XLogP | -0.98 |
| TPSA | 202.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|