C31H31N3O9 — CID 91328574
N-[[(5aR,6aS,10aR)-9-carbamoyl-1,10a,12-trihydroxy-8,10,11-trioxo-4-(4-oxocyclohexa-1,5-dien-1-yl)-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 91328574) has the molecular formula C31H31N3O9 and a molecular weight of 589.60 g/mol. Its IUPAC name is N-[[(5aR,6aS,10aR)-9-carbamoyl-1,10a,12-trihydroxy-8,10,11-trioxo-4-(4-oxocyclohexa-1,5-dien-1-yl)-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-1,10a,12-trihydroxy-8,10,11-trioxo-4-(4-oxocyclohexa-1,5-dien-1-yl)-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91328574 |
| Molecular Formula | C31H31N3O9 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-1,10a,12-trihydroxy-8,10,11-trioxo-4-(4-oxocyclohexa-1,5-dien-1-yl)-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(C5=CCC(=O)C=C5)cc(CNC(=O)C5CCCN5)c(O)c4C(O)=C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C31H31N3O9/c32-29(41)24-21(36)11-16-8-14-9-19-18(13-3-5-17(35)6-4-13)10-15(12-34-30(42)20-2-1-7-33-20)25(37)23(19)26(38)22(14)27(39)31(16,43)28(24)40/h3-5,10,14,16,20,24,33,37-38,43H,1-2,6-9,11-12H2,(H2,32,41)(H,34,42)/t14-,16+,20?,24?,31+/m1/s1 |
| InChIKey | HTBXQODTPMOHHE-ZOMXHANCSA-N |
| XLogP | 0.08 |
| TPSA | 213.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|