C33H34FN3O9 — CID 54699282
N-[[9-carbamoyl-7-(dimethylamino)-4-(4-fluorophenyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]oxolane-2-carboxamide (PubChem CID 54699282) has the molecular formula C33H34FN3O9 and a molecular weight of 635.65 g/mol. Its IUPAC name is N-[[9-carbamoyl-7-(dimethylamino)-4-(4-fluorophenyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]oxolane-2-carboxamide.
| Compound Name | N-[[9-carbamoyl-7-(dimethylamino)-4-(4-fluorophenyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 54699282 |
| Molecular Formula | C33H34FN3O9 |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | N-[[9-carbamoyl-7-(dimethylamino)-4-(4-fluorophenyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]oxolane-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(CNC(=O)C5CCCO5)cc(-c5ccc(F)cc5)c4CC3CC12 |
| InChI | InChI=1S/C33H34FN3O9/c1-37(2)25-20-12-15-10-19-18(14-5-7-17(34)8-6-14)11-16(13-36-32(44)21-4-3-9-46-21)26(38)23(19)27(39)22(15)29(41)33(20,45)30(42)24(28(25)40)31(35)43/h5-8,11,15,20-21,25,38-39,42,45H,3-4,9-10,12-13H2,1-2H3,(H2,35,43)(H,36,44) |
| InChIKey | FBMIFDBCXCIPNQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|