C30H33N3O8S — CID 118504902
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(morpholin-4-ylmethyl)-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118504902) has the molecular formula C30H33N3O8S and a molecular weight of 595.67 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(morpholin-4-ylmethyl)-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(morpholin-4-ylmethyl)-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118504902 |
| Molecular Formula | C30H33N3O8S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(morpholin-4-ylmethyl)-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(CN5CCOCC5)cc(-c5ccsc5)c4CC3CC12 |
| InChI | InChI=1S/C30H33N3O8S/c1-32(2)23-19-11-15-9-18-17(14-3-8-42-13-14)10-16(12-33-4-6-41-7-5-33)24(34)21(18)25(35)20(15)27(37)30(19,40)28(38)22(26(23)36)29(31)39/h3,8,10,13,15,19,23,34-35,38,40H,4-7,9,11-12H2,1-2H3,(H2,31,39) |
| InChIKey | SGIBLLOUWMJTMT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|