C32H38N4O9 — CID 54740547
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[5-(morpholin-4-ylmethyl)furan-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54740547) has the molecular formula C32H38N4O9 and a molecular weight of 622.68 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[5-(morpholin-4-ylmethyl)furan-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[5-(morpholin-4-ylmethyl)furan-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54740547 |
| Molecular Formula | C32H38N4O9 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[5-(morpholin-4-ylmethyl)furan-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(CN3CCOCC3)o2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H38N4O9/c1-34(2)20-13-18(21-6-5-16(45-21)14-36-7-9-44-10-8-36)26(37)23-17(20)11-15-12-19-25(35(3)4)28(39)24(31(33)42)30(41)32(19,43)29(40)22(15)27(23)38/h5-6,13,15,19,25,37-38,41,43H,7-12,14H2,1-4H3,(H2,33,42)/t15-,19-,25-,32-/m0/s1 |
| InChIKey | UHESOAVQJPREAX-XZJXKXEKSA-N |
| XLogP | 1.12 |
| TPSA | 190.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|