C27H34N4O8 — CID 54719094
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719094) has the molecular formula C27H34N4O8 and a molecular weight of 542.59 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719094 |
| Molecular Formula | C27H34N4O8 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(N2CCOCC2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H34N4O8/c1-29(2)15-11-16(31-5-7-39-8-6-31)21(32)18-13(15)9-12-10-14-20(30(3)4)23(34)19(26(28)37)25(36)27(14,38)24(35)17(12)22(18)33/h11-12,14,20,32-33,36,38H,5-10H2,1-4H3,(H2,28,37) |
| InChIKey | LMCBBVSEJSODGF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|