C29H31N3O7 — CID 54680945
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-phenyl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680945) has the molecular formula C29H31N3O7 and a molecular weight of 533.58 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-phenyl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-phenyl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680945 |
| Molecular Formula | C29H31N3O7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-phenyl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccccc2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H31N3O7/c1-31(2)18-12-15(13-8-6-5-7-9-13)23(33)20-16(18)10-14-11-17-22(32(3)4)25(35)21(28(30)38)27(37)29(17,39)26(36)19(14)24(20)34/h5-9,12,14,17,22,33-34,37,39H,10-11H2,1-4H3,(H2,30,38) |
| InChIKey | ABYJJIPOPYOALK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|