C30H31N3O9 — CID 137475894
(4R,4aR,5aR,12aS)-9-(1,3-benzodioxol-5-yl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137475894) has the molecular formula C30H31N3O9 and a molecular weight of 577.59 g/mol. Its IUPAC name is (4R,4aR,5aR,12aS)-9-(1,3-benzodioxol-5-yl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aR,12aS)-9-(1,3-benzodioxol-5-yl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475894 |
| Molecular Formula | C30H31N3O9 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | (4R,4aR,5aR,12aS)-9-(1,3-benzodioxol-5-yl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc3c(c2)OCO3)c(O)c2c1C[C@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H31N3O9/c1-32(2)17-10-14(12-5-6-18-19(9-12)42-11-41-18)24(34)21-15(17)7-13-8-16-23(33(3)4)26(36)22(29(31)39)28(38)30(16,40)27(37)20(13)25(21)35/h5-6,9-10,13,16,23,34-35,38,40H,7-8,11H2,1-4H3,(H2,31,39)/t13-,16+,23+,30+/m0/s1 |
| InChIKey | LAPTXZRZHRHYTL-IQYSTEBPSA-N |
| XLogP | 1.43 |
| TPSA | 183.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|